C19H20FNO5S — CID 2568864
(2-fluorophenyl)methyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 2568864) has the molecular formula C19H20FNO5S and a molecular weight of 393.44 g/mol. Its IUPAC name is (2-fluorophenyl)methyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2-fluorophenyl)methyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2568864 |
| Molecular Formula | C19H20FNO5S |
| Molecular Weight | 393.44 g/mol |
| Exact Mass | 393.10 |
| IUPAC Name | (2-fluorophenyl)methyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)OCc1ccccc1F |
| InChI | InChI=1S/C19H20FNO5S/c1-14-6-7-16(27(23,24)21-8-10-25-11-9-21)12-17(14)19(22)26-13-15-4-2-3-5-18(15)20/h2-7,12H,8-11,13H2,1H3 |
| InChIKey | UVVJDCNBKKTUBX-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.44 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |