C17H18BrNO5S2 — CID 47035280
(5-bromothiophen-3-yl)methyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 47035280) has the molecular formula C17H18BrNO5S2 and a molecular weight of 460.37 g/mol. Its IUPAC name is (5-bromothiophen-3-yl)methyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (5-bromothiophen-3-yl)methyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 47035280 |
| Molecular Formula | C17H18BrNO5S2 |
| Molecular Weight | 460.37 g/mol |
| Exact Mass | 458.98 |
| IUPAC Name | (5-bromothiophen-3-yl)methyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)OCc1csc(Br)c1 |
| InChI | InChI=1S/C17H18BrNO5S2/c1-12-2-3-14(26(21,22)19-4-6-23-7-5-19)9-15(12)17(20)24-10-13-8-16(18)25-11-13/h2-3,8-9,11H,4-7,10H2,1H3 |
| InChIKey | GXJULNCLTZJELF-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.37 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |