C21H25NO7S — CID 2652262
2-(4-methoxyphenoxy)ethyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 2652262) has the molecular formula C21H25NO7S and a molecular weight of 435.50 g/mol. Its IUPAC name is 2-(4-methoxyphenoxy)ethyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | 2-(4-methoxyphenoxy)ethyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2652262 |
| Molecular Formula | C21H25NO7S |
| Molecular Weight | 435.50 g/mol |
| Exact Mass | 435.14 |
| IUPAC Name | 2-(4-methoxyphenoxy)ethyl 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | COc1ccc(OCCOC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2C)cc1 |
| InChI | InChI=1S/C21H25NO7S/c1-16-3-8-19(30(24,25)22-9-11-27-12-10-22)15-20(16)21(23)29-14-13-28-18-6-4-17(26-2)5-7-18/h3-8,15H,9-14H2,1-2H3 |
| InChIKey | CGKFMDPAWUMDKJ-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.50 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|