C19H18N2O5S — CID 7913061
(4-cyanophenyl) 2-methyl-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 7913061) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is (4-cyanophenyl) 2-methyl-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (4-cyanophenyl) 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7913061 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (4-cyanophenyl) 2-methyl-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(S(=O)(=O)N2CCOCC2)cc1C(=O)Oc1ccc(C#N)cc1 |
| InChI | InChI=1S/C19H18N2O5S/c1-14-2-7-17(27(23,24)21-8-10-25-11-9-21)12-18(14)19(22)26-16-5-3-15(13-20)4-6-16/h2-7,12H,8-11H2,1H3 |
| InChIKey | JGWWRCPRTPIEAA-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 96.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|