C19H19ClFNO5S — CID 52647847
(4-chloro-3,5-dimethylphenyl) 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 52647847) has the molecular formula C19H19ClFNO5S and a molecular weight of 427.88 g/mol. Its IUPAC name is (4-chloro-3,5-dimethylphenyl) 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (4-chloro-3,5-dimethylphenyl) 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 52647847 |
| Molecular Formula | C19H19ClFNO5S |
| Molecular Weight | 427.88 g/mol |
| Exact Mass | 427.07 |
| IUPAC Name | (4-chloro-3,5-dimethylphenyl) 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1cc(OC(=O)c2cc(S(=O)(=O)N3CCOCC3)ccc2F)cc(C)c1Cl |
| InChI | InChI=1S/C19H19ClFNO5S/c1-12-9-14(10-13(2)18(12)20)27-19(23)16-11-15(3-4-17(16)21)28(24,25)22-5-7-26-8-6-22/h3-4,9-11H,5-8H2,1-2H3 |
| InChIKey | UXWJCZPHWSDWPX-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.88 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|