C14H16FN3O7S — CID 4218282
[2-(carbamoylamino)-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 4218282) has the molecular formula C14H16FN3O7S and a molecular weight of 389.36 g/mol. Its IUPAC name is [2-(carbamoylamino)-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(carbamoylamino)-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 4218282 |
| Molecular Formula | C14H16FN3O7S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 389.07 |
| IUPAC Name | [2-(carbamoylamino)-2-oxoethyl] 2-fluoro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | NC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C14H16FN3O7S/c15-11-2-1-9(26(22,23)18-3-5-24-6-4-18)7-10(11)13(20)25-8-12(19)17-14(16)21/h1-2,7H,3-6,8H2,(H3,16,17,19,21) |
| InChIKey | YJJLZYVXMZQHNY-UHFFFAOYSA-N |
| XLogP | -0.80 |
| TPSA | 145.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |