C13H16FN3O5S — CID 9295127
N-(2-amino-2-oxoethyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide (PubChem CID 9295127) has the molecular formula C13H16FN3O5S and a molecular weight of 345.35 g/mol. Its IUPAC name is N-(2-amino-2-oxoethyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-(2-amino-2-oxoethyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 9295127 |
| Molecular Formula | C13H16FN3O5S |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | N-(2-amino-2-oxoethyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzamide |
| SMILES | NC(=O)CNC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F |
| InChI | InChI=1S/C13H16FN3O5S/c14-11-2-1-9(7-10(11)13(19)16-8-12(15)18)23(20,21)17-3-5-22-6-4-17/h1-2,7H,3-6,8H2,(H2,15,18)(H,16,19) |
| InChIKey | HEVXWSCWRLYTHA-UHFFFAOYSA-N |
| XLogP | -0.94 |
| TPSA | 118.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | -0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |