C18H17BrFN3O5S — CID 24640878
N'-(4-bromobenzoyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzohydrazide (PubChem CID 24640878) has the molecular formula C18H17BrFN3O5S and a molecular weight of 486.32 g/mol. Its IUPAC name is N'-(4-bromobenzoyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzohydrazide.
| Compound Name | N'-(4-bromobenzoyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzohydrazide |
|---|---|
| PubChem CID | 24640878 |
| Molecular Formula | C18H17BrFN3O5S |
| Molecular Weight | 486.32 g/mol |
| Exact Mass | 485.01 |
| IUPAC Name | N'-(4-bromobenzoyl)-2-fluoro-5-morpholin-4-ylsulfonylbenzohydrazide |
| SMILES | O=C(NNC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C18H17BrFN3O5S/c19-13-3-1-12(2-4-13)17(24)21-22-18(25)15-11-14(5-6-16(15)20)29(26,27)23-7-9-28-10-8-23/h1-6,11H,7-10H2,(H,21,24)(H,22,25) |
| InChIKey | WMDNJVPBELZMAV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 104.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.32 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|