C18H17FN4O7S — CID 24640858
2-fluoro-5-morpholin-4-ylsulfonyl-N'-(3-nitrobenzoyl)benzohydrazide (PubChem CID 24640858) has the molecular formula C18H17FN4O7S and a molecular weight of 452.42 g/mol. Its IUPAC name is 2-fluoro-5-morpholin-4-ylsulfonyl-N'-(3-nitrobenzoyl)benzohydrazide.
| Compound Name | 2-fluoro-5-morpholin-4-ylsulfonyl-N'-(3-nitrobenzoyl)benzohydrazide |
|---|---|
| PubChem CID | 24640858 |
| Molecular Formula | C18H17FN4O7S |
| Molecular Weight | 452.42 g/mol |
| Exact Mass | 452.08 |
| IUPAC Name | 2-fluoro-5-morpholin-4-ylsulfonyl-N'-(3-nitrobenzoyl)benzohydrazide |
| SMILES | O=C(NNC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1F)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C18H17FN4O7S/c19-16-5-4-14(31(28,29)22-6-8-30-9-7-22)11-15(16)18(25)21-20-17(24)12-2-1-3-13(10-12)23(26)27/h1-5,10-11H,6-9H2,(H,20,24)(H,21,25) |
| InChIKey | YCCGEWFUPJAEJM-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 147.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.42 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|