C19H19N3O8S — CID 4687464
[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-nitrobenzoate (PubChem CID 4687464) has the molecular formula C19H19N3O8S and a molecular weight of 449.44 g/mol. Its IUPAC name is [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-nitrobenzoate.
| Compound Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-nitrobenzoate |
|---|---|
| PubChem CID | 4687464 |
| Molecular Formula | C19H19N3O8S |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.09 |
| IUPAC Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-nitrobenzoate |
| SMILES | O=C(COC(=O)c1cccc([N+](=O)[O-])c1)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C19H19N3O8S/c23-18(13-30-19(24)14-3-1-5-16(11-14)22(25)26)20-15-4-2-6-17(12-15)31(27,28)21-7-9-29-10-8-21/h1-6,11-12H,7-10,13H2,(H,20,23) |
| InChIKey | BMDMYJCNNPXNRS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|