C20H22N2O6S — CID 4853968
[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-methylbenzoate (PubChem CID 4853968) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-methylbenzoate.
| Compound Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-methylbenzoate |
|---|---|
| PubChem CID | 4853968 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)OCC(=O)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H22N2O6S/c1-15-5-2-3-8-18(15)20(24)28-14-19(23)21-16-6-4-7-17(13-16)29(25,26)22-9-11-27-12-10-22/h2-8,13H,9-12,14H2,1H3,(H,21,23) |
| InChIKey | XQXPBGZJTVDODK-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |