C20H19F3N2O6S — CID 4854118
[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate (PubChem CID 4854118) has the molecular formula C20H19F3N2O6S and a molecular weight of 472.44 g/mol. Its IUPAC name is [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate.
| Compound Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
|---|---|
| PubChem CID | 4854118 |
| Molecular Formula | C20H19F3N2O6S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.09 |
| IUPAC Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-(trifluoromethyl)benzoate |
| SMILES | O=C(COC(=O)c1cccc(C(F)(F)F)c1)Nc1cccc(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C20H19F3N2O6S/c21-20(22,23)15-4-1-3-14(11-15)19(27)31-13-18(26)24-16-5-2-6-17(12-16)32(28,29)25-7-9-30-10-8-25/h1-6,11-12H,7-10,13H2,(H,24,26) |
| InChIKey | LDRWXPCDDZQVNN-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |