C18H20N2O7S — CID 4854297
[2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-methylfuran-2-carboxylate (PubChem CID 4854297) has the molecular formula C18H20N2O7S and a molecular weight of 408.43 g/mol. Its IUPAC name is [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-methylfuran-2-carboxylate.
| Compound Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-methylfuran-2-carboxylate |
|---|---|
| PubChem CID | 4854297 |
| Molecular Formula | C18H20N2O7S |
| Molecular Weight | 408.43 g/mol |
| Exact Mass | 408.10 |
| IUPAC Name | [2-(3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 5-methylfuran-2-carboxylate |
| SMILES | Cc1ccc(C(=O)OCC(=O)Nc2cccc(S(=O)(=O)N3CCOCC3)c2)o1 |
| InChI | InChI=1S/C18H20N2O7S/c1-13-5-6-16(27-13)18(22)26-12-17(21)19-14-3-2-4-15(11-14)28(23,24)20-7-9-25-10-8-20/h2-6,11H,7-10,12H2,1H3,(H,19,21) |
| InChIKey | XOJLLNOBLHOPOZ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 115.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.43 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |