C19H18ClN3O8S — CID 55314449
[2-(4-chloro-3-nitroanilino)-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate (PubChem CID 55314449) has the molecular formula C19H18ClN3O8S and a molecular weight of 483.89 g/mol. Its IUPAC name is [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55314449 |
| Molecular Formula | C19H18ClN3O8S |
| Molecular Weight | 483.89 g/mol |
| Exact Mass | 483.05 |
| IUPAC Name | [2-(4-chloro-3-nitroanilino)-2-oxoethyl] 4-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(S(=O)(=O)N2CCOCC2)cc1)Nc1ccc(Cl)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C19H18ClN3O8S/c20-16-6-3-14(11-17(16)23(26)27)21-18(24)12-31-19(25)13-1-4-15(5-2-13)32(28,29)22-7-9-30-10-8-22/h1-6,11H,7-10,12H2,(H,21,24) |
| InChIKey | FHDWJYZCHKSHPP-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.89 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|