C19H19Cl2N3O6S — CID 5016661
[2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate (PubChem CID 5016661) has the molecular formula C19H19Cl2N3O6S and a molecular weight of 488.35 g/mol. Its IUPAC name is [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate.
| Compound Name | [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate |
|---|---|
| PubChem CID | 5016661 |
| Molecular Formula | C19H19Cl2N3O6S |
| Molecular Weight | 488.35 g/mol |
| Exact Mass | 487.04 |
| IUPAC Name | [2-(4-chloro-3-morpholin-4-ylsulfonylanilino)-2-oxoethyl] 3-amino-4-chlorobenzoate |
| SMILES | Nc1cc(C(=O)OCC(=O)Nc2ccc(Cl)c(S(=O)(=O)N3CCOCC3)c2)ccc1Cl |
| InChI | InChI=1S/C19H19Cl2N3O6S/c20-14-3-1-12(9-16(14)22)19(26)30-11-18(25)23-13-2-4-15(21)17(10-13)31(27,28)24-5-7-29-8-6-24/h1-4,9-10H,5-8,11,22H2,(H,23,25) |
| InChIKey | BVVJJCLVEOSLRK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 128.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|