C13H15ClN2O6S — CID 7667130
(2-amino-2-oxoethyl) 4-chloro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 7667130) has the molecular formula C13H15ClN2O6S and a molecular weight of 362.79 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 4-chloro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2-amino-2-oxoethyl) 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7667130 |
| Molecular Formula | C13H15ClN2O6S |
| Molecular Weight | 362.79 g/mol |
| Exact Mass | 362.03 |
| IUPAC Name | (2-amino-2-oxoethyl) 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | NC(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C13H15ClN2O6S/c14-10-2-1-9(13(18)22-8-12(15)17)7-11(10)23(19,20)16-3-5-21-6-4-16/h1-2,7H,3-6,8H2,(H2,15,17) |
| InChIKey | IXCMGQKWCZZDOT-UHFFFAOYSA-N |
| XLogP | 0.00 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.79 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |