C17H23ClN2O6S — CID 7667091
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 7667091) has the molecular formula C17H23ClN2O6S and a molecular weight of 418.90 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7667091 |
| Molecular Formula | C17H23ClN2O6S |
| Molecular Weight | 418.90 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CC[C@@H](C)NC(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C17H23ClN2O6S/c1-3-12(2)19-16(21)11-26-17(22)13-4-5-14(18)15(10-13)27(23,24)20-6-8-25-9-7-20/h4-5,10,12H,3,6-9,11H2,1-2H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | UCCPCMSCMGJWEY-GFCCVEGCSA-N |
| XLogP | 1.43 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.90 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |