C16H21ClN2O6S — CID 9416375
[(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 9416375) has the molecular formula C16H21ClN2O6S and a molecular weight of 404.87 g/mol. Its IUPAC name is [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 9416375 |
| Molecular Formula | C16H21ClN2O6S |
| Molecular Weight | 404.87 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | [(2R)-1-(ethylamino)-1-oxopropan-2-yl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCNC(=O)[C@@H](C)OC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C16H21ClN2O6S/c1-3-18-15(20)11(2)25-16(21)12-4-5-13(17)14(10-12)26(22,23)19-6-8-24-9-7-19/h4-5,10-11H,3,6-9H2,1-2H3,(H,18,20)/t11-/m1/s1 |
| InChIKey | ICTNJMGPKSGAJI-LLVKDONJSA-N |
| XLogP | 1.04 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.87 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |