C20H20ClN3O8S — CID 55313272
[1-(3-nitroanilino)-1-oxopropan-2-yl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 55313272) has the molecular formula C20H20ClN3O8S and a molecular weight of 497.91 g/mol. Its IUPAC name is [1-(3-nitroanilino)-1-oxopropan-2-yl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 55313272 |
| Molecular Formula | C20H20ClN3O8S |
| Molecular Weight | 497.91 g/mol |
| Exact Mass | 497.07 |
| IUPAC Name | [1-(3-nitroanilino)-1-oxopropan-2-yl] 4-chloro-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CC(OC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCOCC2)c1)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H20ClN3O8S/c1-13(19(25)22-15-3-2-4-16(12-15)24(27)28)32-20(26)14-5-6-17(21)18(11-14)33(29,30)23-7-9-31-10-8-23/h2-6,11-13H,7-10H2,1H3,(H,22,25) |
| InChIKey | KHYYNIOYUWKVJP-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 145.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.91 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|