C18H25N3O7S — CID 5012699
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 5012699) has the molecular formula C18H25N3O7S and a molecular weight of 427.48 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 5012699 |
| Molecular Formula | C18H25N3O7S |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)c1ccc(C)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C18H25N3O7S/c1-4-19-18(24)20-16(22)13(3)28-17(23)14-6-5-12(2)15(11-14)29(25,26)21-7-9-27-10-8-21/h5-6,11,13H,4,7-10H2,1-3H3,(H2,19,20,22,24) |
| InChIKey | KYFKZEJVHKPUDR-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |