C18H27N3O6S — CID 46791176
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)-4-methylbenzoate (PubChem CID 46791176) has the molecular formula C18H27N3O6S and a molecular weight of 413.50 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)-4-methylbenzoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)-4-methylbenzoate |
|---|---|
| PubChem CID | 46791176 |
| Molecular Formula | C18H27N3O6S |
| Molecular Weight | 413.50 g/mol |
| Exact Mass | 413.16 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 3-(diethylsulfamoyl)-4-methylbenzoate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)c1ccc(C)c(S(=O)(=O)N(CC)CC)c1 |
| InChI | InChI=1S/C18H27N3O6S/c1-6-19-18(24)20-16(22)13(5)27-17(23)14-10-9-12(4)15(11-14)28(25,26)21(7-2)8-3/h9-11,13H,6-8H2,1-5H3,(H2,19,20,22,24) |
| InChIKey | ACKHYYDMZXYOLS-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.50 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |