C14H18N2O6S — CID 16514633
[1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate (PubChem CID 16514633) has the molecular formula C14H18N2O6S and a molecular weight of 342.37 g/mol. Its IUPAC name is [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate.
| Compound Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 16514633 |
| Molecular Formula | C14H18N2O6S |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [1-(ethylcarbamoylamino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate |
| SMILES | CCNC(=O)NC(=O)C(C)OC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H18N2O6S/c1-4-15-14(19)16-12(17)9(2)22-13(18)10-5-7-11(8-6-10)23(3,20)21/h5-9H,4H2,1-3H3,(H2,15,16,17,19) |
| InChIKey | WUHSDECLLCVECY-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |