C13H16N2O6S — CID 16514628
[1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate (PubChem CID 16514628) has the molecular formula C13H16N2O6S and a molecular weight of 328.35 g/mol. Its IUPAC name is [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate.
| Compound Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 16514628 |
| Molecular Formula | C13H16N2O6S |
| Molecular Weight | 328.35 g/mol |
| Exact Mass | 328.07 |
| IUPAC Name | [1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate |
| SMILES | CNC(=O)NC(=O)C(C)OC(=O)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H16N2O6S/c1-8(11(16)15-13(18)14-2)21-12(17)9-4-6-10(7-5-9)22(3,19)20/h4-8H,1-3H3,(H2,14,15,16,18) |
| InChIKey | IZXCWAQHRCMGCY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 118.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |