C19H21NO5S — CID 16514558
[1-(4-ethylanilino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate (PubChem CID 16514558) has the molecular formula C19H21NO5S and a molecular weight of 375.45 g/mol. Its IUPAC name is [1-(4-ethylanilino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate.
| Compound Name | [1-(4-ethylanilino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 16514558 |
| Molecular Formula | C19H21NO5S |
| Molecular Weight | 375.45 g/mol |
| Exact Mass | 375.11 |
| IUPAC Name | [1-(4-ethylanilino)-1-oxopropan-2-yl] 4-methylsulfonylbenzoate |
| SMILES | CCc1ccc(NC(=O)C(C)OC(=O)c2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C19H21NO5S/c1-4-14-5-9-16(10-6-14)20-18(21)13(2)25-19(22)15-7-11-17(12-8-15)26(3,23)24/h5-13H,4H2,1-3H3,(H,20,21) |
| InChIKey | TVJODMXXNOQYFC-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.45 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |