C23H24N2O6S — CID 2098581
[(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 2098581) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is [(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2098581 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [(2S)-1-(4-ethylanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | CCc1ccc(NC(=O)[C@H](C)OC(=O)c2ccc(S(=O)(=O)NCc3ccco3)cc2)cc1 |
| InChI | InChI=1S/C23H24N2O6S/c1-3-17-6-10-19(11-7-17)25-22(26)16(2)31-23(27)18-8-12-21(13-9-18)32(28,29)24-15-20-5-4-14-30-20/h4-14,16,24H,3,15H2,1-2H3,(H,25,26)/t16-/m0/s1 |
| InChIKey | VPYZHNTWYIPWQV-INIZCTEOSA-N |
| XLogP | 3.50 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |