C22H21N3O9S — CID 2118377
[(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 2118377) has the molecular formula C22H21N3O9S and a molecular weight of 503.49 g/mol. Its IUPAC name is [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2118377 |
| Molecular Formula | C22H21N3O9S |
| Molecular Weight | 503.49 g/mol |
| Exact Mass | 503.10 |
| IUPAC Name | [(2S)-1-(2-methoxy-5-nitroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | COc1ccc([N+](=O)[O-])cc1NC(=O)[C@H](C)OC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C22H21N3O9S/c1-14(21(26)24-19-12-16(25(28)29)7-10-20(19)32-2)34-22(27)15-5-8-18(9-6-15)35(30,31)23-13-17-4-3-11-33-17/h3-12,14,23H,13H2,1-2H3,(H,24,26)/t14-/m0/s1 |
| InChIKey | FXMMAAPHNIIOKB-AWEZNQCLSA-N |
| XLogP | 2.86 |
| TPSA | 167.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.49 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|