C21H19FN2O6S — CID 2550072
[(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 2550072) has the molecular formula C21H19FN2O6S and a molecular weight of 446.46 g/mol. Its IUPAC name is [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 2550072 |
| Molecular Formula | C21H19FN2O6S |
| Molecular Weight | 446.46 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | [(2R)-1-(2-fluoroanilino)-1-oxopropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | C[C@@H](OC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C21H19FN2O6S/c1-14(20(25)24-19-7-3-2-6-18(19)22)30-21(26)15-8-10-17(11-9-15)31(27,28)23-13-16-5-4-12-29-16/h2-12,14,23H,13H2,1H3,(H,24,25)/t14-/m1/s1 |
| InChIKey | UFKHZISVGAOOBZ-CQSZACIVSA-N |
| XLogP | 3.08 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.46 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |