C20H24N2O6S — CID 8663364
[(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 8663364) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is [(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 8663364 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | [(2S)-1-oxo-1-piperidin-1-ylpropan-2-yl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | C[C@H](OC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)C(=O)N1CCCCC1 |
| InChI | InChI=1S/C20H24N2O6S/c1-15(19(23)22-11-3-2-4-12-22)28-20(24)16-7-9-18(10-8-16)29(25,26)21-14-17-6-5-13-27-17/h5-10,13,15,21H,2-4,11-12,14H2,1H3/t15-/m0/s1 |
| InChIKey | ZHJAZUKCSLZAII-HNNXBMFYSA-N |
| XLogP | 2.32 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |