C28H26N2O7S — CID 3533023
[2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate (PubChem CID 3533023) has the molecular formula C28H26N2O7S and a molecular weight of 534.59 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 3533023 |
| Molecular Formula | C28H26N2O7S |
| Molecular Weight | 534.59 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-(furan-2-ylmethylsulfamoyl)benzoate |
| SMILES | COc1ccc(C)cc1NC(=O)C(OC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)c1ccccc1 |
| InChI | InChI=1S/C28H26N2O7S/c1-19-10-15-25(35-2)24(17-19)30-27(31)26(20-7-4-3-5-8-20)37-28(32)21-11-13-23(14-12-21)38(33,34)29-18-22-9-6-16-36-22/h3-17,26,29H,18H2,1-2H3,(H,30,31) |
| InChIKey | HPKWMIMVSAVQQP-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 123.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.59 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |