C24H23NO6S — CID 2665441
[(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-methylsulfonylbenzoate (PubChem CID 2665441) has the molecular formula C24H23NO6S and a molecular weight of 453.52 g/mol. Its IUPAC name is [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-methylsulfonylbenzoate.
| Compound Name | [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-methylsulfonylbenzoate |
|---|---|
| PubChem CID | 2665441 |
| Molecular Formula | C24H23NO6S |
| Molecular Weight | 453.52 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | [(1R)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-methylsulfonylbenzoate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@H](OC(=O)c1ccc(S(C)(=O)=O)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO6S/c1-16-9-14-21(30-2)20(15-16)25-23(26)22(17-7-5-4-6-8-17)31-24(27)18-10-12-19(13-11-18)32(3,28)29/h4-15,22H,1-3H3,(H,25,26)/t22-/m1/s1 |
| InChIKey | TUARMCUTKXFSRN-JOCHJYFZSA-N |
| XLogP | 3.94 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.52 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |