C24H21N5O4 — CID 2665146
[(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-(tetrazol-1-yl)benzoate (PubChem CID 2665146) has the molecular formula C24H21N5O4 and a molecular weight of 443.46 g/mol. Its IUPAC name is [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-(tetrazol-1-yl)benzoate.
| Compound Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-(tetrazol-1-yl)benzoate |
|---|---|
| PubChem CID | 2665146 |
| Molecular Formula | C24H21N5O4 |
| Molecular Weight | 443.46 g/mol |
| Exact Mass | 443.16 |
| IUPAC Name | [(1S)-2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 4-(tetrazol-1-yl)benzoate |
| SMILES | COc1ccc(C)cc1NC(=O)[C@@H](OC(=O)c1ccc(-n2cnnn2)cc1)c1ccccc1 |
| InChI | InChI=1S/C24H21N5O4/c1-16-8-13-21(32-2)20(14-16)26-23(30)22(17-6-4-3-5-7-17)33-24(31)18-9-11-19(12-10-18)29-15-25-27-28-29/h3-15,22H,1-2H3,(H,26,30)/t22-/m0/s1 |
| InChIKey | KBAFHBLCOYNOQA-QFIPXVFZSA-N |
| XLogP | 3.52 |
| TPSA | 108.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |