C31H27NO5 — CID 3518860
[2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(4-methylbenzoyl)benzoate (PubChem CID 3518860) has the molecular formula C31H27NO5 and a molecular weight of 493.56 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(4-methylbenzoyl)benzoate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(4-methylbenzoyl)benzoate |
|---|---|
| PubChem CID | 3518860 |
| Molecular Formula | C31H27NO5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.19 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-(4-methylbenzoyl)benzoate |
| SMILES | COc1ccc(C)cc1NC(=O)C(OC(=O)c1ccccc1C(=O)c1ccc(C)cc1)c1ccccc1 |
| InChI | InChI=1S/C31H27NO5/c1-20-13-16-22(17-14-20)28(33)24-11-7-8-12-25(24)31(35)37-29(23-9-5-4-6-10-23)30(34)32-26-19-21(2)15-18-27(26)36-3/h4-19,29H,1-3H3,(H,32,34) |
| InChIKey | ABRSZKXPXFFUED-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |