C27H23NO4 — CID 3600454
[2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] naphthalene-1-carboxylate (PubChem CID 3600454) has the molecular formula C27H23NO4 and a molecular weight of 425.48 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] naphthalene-1-carboxylate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] naphthalene-1-carboxylate |
|---|---|
| PubChem CID | 3600454 |
| Molecular Formula | C27H23NO4 |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] naphthalene-1-carboxylate |
| SMILES | COc1ccc(C)cc1NC(=O)C(OC(=O)c1cccc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C27H23NO4/c1-18-15-16-24(31-2)23(17-18)28-26(29)25(20-10-4-3-5-11-20)32-27(30)22-14-8-12-19-9-6-7-13-21(19)22/h3-17,25H,1-2H3,(H,28,29) |
| InChIKey | DDXMKNOPFYDXSY-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |