C31H25N3O4 — CID 23794735
[2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-pyridin-4-ylquinoline-4-carboxylate (PubChem CID 23794735) has the molecular formula C31H25N3O4 and a molecular weight of 503.56 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-pyridin-4-ylquinoline-4-carboxylate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-pyridin-4-ylquinoline-4-carboxylate |
|---|---|
| PubChem CID | 23794735 |
| Molecular Formula | C31H25N3O4 |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxo-1-phenylethyl] 2-pyridin-4-ylquinoline-4-carboxylate |
| SMILES | COc1ccc(C)cc1NC(=O)C(OC(=O)c1cc(-c2ccncc2)nc2ccccc12)c1ccccc1 |
| InChI | InChI=1S/C31H25N3O4/c1-20-12-13-28(37-2)27(18-20)34-30(35)29(22-8-4-3-5-9-22)38-31(36)24-19-26(21-14-16-32-17-15-21)33-25-11-7-6-10-23(24)25/h3-19,29H,1-2H3,(H,34,35) |
| InChIKey | VDNSHXVOEIUKOG-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |