C15H19NO7S — CID 16568664
(2-methoxy-2-oxoethyl) 4-methyl-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 16568664) has the molecular formula C15H19NO7S and a molecular weight of 357.38 g/mol. Its IUPAC name is (2-methoxy-2-oxoethyl) 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | (2-methoxy-2-oxoethyl) 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16568664 |
| Molecular Formula | C15H19NO7S |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | (2-methoxy-2-oxoethyl) 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | COC(=O)COC(=O)c1ccc(C)c(S(=O)(=O)N2CCOCC2)c1 |
| InChI | InChI=1S/C15H19NO7S/c1-11-3-4-12(15(18)23-10-14(17)21-2)9-13(11)24(19,20)16-5-7-22-8-6-16/h3-4,9H,5-8,10H2,1-2H3 |
| InChIKey | GGZTXWAIXIAWAO-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |