C20H28N2O6S — CID 7825374
[2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate (PubChem CID 7825374) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 7825374 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | [2-[(3R)-3-methylpiperidin-1-yl]-2-oxoethyl] 4-methyl-3-morpholin-4-ylsulfonylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)N2CCC[C@@H](C)C2)cc1S(=O)(=O)N1CCOCC1 |
| InChI | InChI=1S/C20H28N2O6S/c1-15-4-3-7-21(13-15)19(23)14-28-20(24)17-6-5-16(2)18(12-17)29(25,26)22-8-10-27-11-9-22/h5-6,12,15H,3-4,7-11,13-14H2,1-2H3/t15-/m1/s1 |
| InChIKey | PATACXXLZQMZIY-OAHLLOKOSA-N |
| XLogP | 1.43 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |