C17H21ClN2O6S — CID 2433649
(2-morpholin-4-yl-2-oxoethyl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2433649) has the molecular formula C17H21ClN2O6S and a molecular weight of 416.88 g/mol. Its IUPAC name is (2-morpholin-4-yl-2-oxoethyl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | (2-morpholin-4-yl-2-oxoethyl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2433649 |
| Molecular Formula | C17H21ClN2O6S |
| Molecular Weight | 416.88 g/mol |
| Exact Mass | 416.08 |
| IUPAC Name | (2-morpholin-4-yl-2-oxoethyl) 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(OCC(=O)N1CCOCC1)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C17H21ClN2O6S/c18-14-4-3-13(11-15(14)27(23,24)20-5-1-2-6-20)17(22)26-12-16(21)19-7-9-25-10-8-19/h3-4,11H,1-2,5-10,12H2 |
| InChIKey | FXOGORFCRFXNHJ-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 93.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.88 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |