C23H31ClN2O7S — CID 4147904
ethyl 1-[2-[3-(azepan-1-ylsulfonyl)-4-chlorobenzoyl]oxyacetyl]piperidine-4-carboxylate (PubChem CID 4147904) has the molecular formula C23H31ClN2O7S and a molecular weight of 515.03 g/mol. Its IUPAC name is ethyl 1-[2-[3-(azepan-1-ylsulfonyl)-4-chlorobenzoyl]oxyacetyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[2-[3-(azepan-1-ylsulfonyl)-4-chlorobenzoyl]oxyacetyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 4147904 |
| Molecular Formula | C23H31ClN2O7S |
| Molecular Weight | 515.03 g/mol |
| Exact Mass | 514.15 |
| IUPAC Name | ethyl 1-[2-[3-(azepan-1-ylsulfonyl)-4-chlorobenzoyl]oxyacetyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)COC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCCC3)c2)CC1 |
| InChI | InChI=1S/C23H31ClN2O7S/c1-2-32-22(28)17-9-13-25(14-10-17)21(27)16-33-23(29)18-7-8-19(24)20(15-18)34(30,31)26-11-5-3-4-6-12-26/h7-8,15,17H,2-6,9-14,16H2,1H3 |
| InChIKey | LTKZBWVYTKJMHE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 110.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.03 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |