C21H29ClN2O5S — CID 42970356
[2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 42970356) has the molecular formula C21H29ClN2O5S and a molecular weight of 456.99 g/mol. Its IUPAC name is [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 42970356 |
| Molecular Formula | C21H29ClN2O5S |
| Molecular Weight | 456.99 g/mol |
| Exact Mass | 456.15 |
| IUPAC Name | [2-[(4-methylcyclohexyl)amino]-2-oxoethyl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC1CCC(NC(=O)COC(=O)c2ccc(Cl)c(S(=O)(=O)N3CCCCC3)c2)CC1 |
| InChI | InChI=1S/C21H29ClN2O5S/c1-15-5-8-17(9-6-15)23-20(25)14-29-21(26)16-7-10-18(22)19(13-16)30(27,28)24-11-3-2-4-12-24/h7,10,13,15,17H,2-6,8-9,11-12,14H2,1H3,(H,23,25) |
| InChIKey | ICIVASHOPPLAEB-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.99 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |