C17H22ClN3O6S — CID 2550455
[2-(methylcarbamoylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate (PubChem CID 2550455) has the molecular formula C17H22ClN3O6S and a molecular weight of 431.90 g/mol. Its IUPAC name is [2-(methylcarbamoylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate.
| Compound Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
|---|---|
| PubChem CID | 2550455 |
| Molecular Formula | C17H22ClN3O6S |
| Molecular Weight | 431.90 g/mol |
| Exact Mass | 431.09 |
| IUPAC Name | [2-(methylcarbamoylamino)-2-oxoethyl] 3-(azepan-1-ylsulfonyl)-4-chlorobenzoate |
| SMILES | CNC(=O)NC(=O)COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCCCC2)c1 |
| InChI | InChI=1S/C17H22ClN3O6S/c1-19-17(24)20-15(22)11-27-16(23)12-6-7-13(18)14(10-12)28(25,26)21-8-4-2-3-5-9-21/h6-7,10H,2-5,8-9,11H2,1H3,(H2,19,20,22,24) |
| InChIKey | QQAYFGQBXBHFHJ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.90 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |