C21H22Cl2N2O5S — CID 2514204
[2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate (PubChem CID 2514204) has the molecular formula C21H22Cl2N2O5S and a molecular weight of 485.39 g/mol. Its IUPAC name is [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2514204 |
| Molecular Formula | C21H22Cl2N2O5S |
| Molecular Weight | 485.39 g/mol |
| Exact Mass | 484.06 |
| IUPAC Name | [2-[(2-chlorophenyl)methylamino]-2-oxoethyl] 4-chloro-3-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCCC2)c1)NCc1ccccc1Cl |
| InChI | InChI=1S/C21H22Cl2N2O5S/c22-17-7-3-2-6-16(17)13-24-20(26)14-30-21(27)15-8-9-18(23)19(12-15)31(28,29)25-10-4-1-5-11-25/h2-3,6-9,12H,1,4-5,10-11,13-14H2,(H,24,26) |
| InChIKey | USJJCNSXHLMLKW-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.39 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |