C19H18Cl2N2O5S — CID 2513890
[2-(3-chloroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2513890) has the molecular formula C19H18Cl2N2O5S and a molecular weight of 457.34 g/mol. Its IUPAC name is [2-(3-chloroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(3-chloroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2513890 |
| Molecular Formula | C19H18Cl2N2O5S |
| Molecular Weight | 457.34 g/mol |
| Exact Mass | 456.03 |
| IUPAC Name | [2-(3-chloroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C19H18Cl2N2O5S/c20-14-4-3-5-15(11-14)22-18(24)12-28-19(25)13-6-7-16(21)17(10-13)29(26,27)23-8-1-2-9-23/h3-7,10-11H,1-2,8-9,12H2,(H,22,24) |
| InChIKey | VVPSUFISKWFOBA-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.34 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |