C19H17Cl2FN2O5S — CID 16522179
[2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 16522179) has the molecular formula C19H17Cl2FN2O5S and a molecular weight of 475.33 g/mol. Its IUPAC name is [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16522179 |
| Molecular Formula | C19H17Cl2FN2O5S |
| Molecular Weight | 475.33 g/mol |
| Exact Mass | 474.02 |
| IUPAC Name | [2-(4-chloro-2-fluoroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)Nc1ccc(Cl)cc1F |
| InChI | InChI=1S/C19H17Cl2FN2O5S/c20-13-4-6-16(15(22)10-13)23-18(25)11-29-19(26)12-3-5-14(21)17(9-12)30(27,28)24-7-1-2-8-24/h3-6,9-10H,1-2,7-8,11H2,(H,23,25) |
| InChIKey | USBGGFQNOYVVDR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |