C19H17ClF2N2O5S — CID 2513870
[2-(2,4-difluoroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate (PubChem CID 2513870) has the molecular formula C19H17ClF2N2O5S and a molecular weight of 458.87 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2513870 |
| Molecular Formula | C19H17ClF2N2O5S |
| Molecular Weight | 458.87 g/mol |
| Exact Mass | 458.05 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 4-chloro-3-pyrrolidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1ccc(Cl)c(S(=O)(=O)N2CCCC2)c1)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C19H17ClF2N2O5S/c20-14-5-3-12(9-17(14)30(27,28)24-7-1-2-8-24)19(26)29-11-18(25)23-16-6-4-13(21)10-15(16)22/h3-6,9-10H,1-2,7-8,11H2,(H,23,25) |
| InChIKey | XWNBEEZUGLWBBK-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.87 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |