C20H19ClF2N2O5S — CID 16533453
[2-(2,4-difluoroanilino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 16533453) has the molecular formula C20H19ClF2N2O5S and a molecular weight of 472.90 g/mol. Its IUPAC name is [2-(2,4-difluoroanilino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16533453 |
| Molecular Formula | C20H19ClF2N2O5S |
| Molecular Weight | 472.90 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | [2-(2,4-difluoroanilino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl)Nc1ccc(F)cc1F |
| InChI | InChI=1S/C20H19ClF2N2O5S/c21-16-6-5-14(31(28,29)25-8-2-1-3-9-25)11-15(16)20(27)30-12-19(26)24-18-7-4-13(22)10-17(18)23/h4-7,10-11H,1-3,8-9,12H2,(H,24,26) |
| InChIKey | UQXAROIXSQHFHI-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.90 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |