C18H25ClN2O5S — CID 2599155
[2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 2599155) has the molecular formula C18H25ClN2O5S and a molecular weight of 416.93 g/mol. Its IUPAC name is [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 2599155 |
| Molecular Formula | C18H25ClN2O5S |
| Molecular Weight | 416.93 g/mol |
| Exact Mass | 416.12 |
| IUPAC Name | [2-[[(2R)-butan-2-yl]amino]-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | CC[C@@H](C)NC(=O)COC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C18H25ClN2O5S/c1-3-13(2)20-17(22)12-26-18(23)15-11-14(7-8-16(15)19)27(24,25)21-9-5-4-6-10-21/h7-8,11,13H,3-6,9-10,12H2,1-2H3,(H,20,22)/t13-/m1/s1 |
| InChIKey | LVSIUKAFOPELNV-CYBMUJFWSA-N |
| XLogP | 2.59 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.93 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |