C18H24ClN3O7S — CID 16533443
[2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate (PubChem CID 16533443) has the molecular formula C18H24ClN3O7S and a molecular weight of 461.92 g/mol. Its IUPAC name is [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate.
| Compound Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16533443 |
| Molecular Formula | C18H24ClN3O7S |
| Molecular Weight | 461.92 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | [2-(2-methoxyethylcarbamoylamino)-2-oxoethyl] 2-chloro-5-piperidin-1-ylsulfonylbenzoate |
| SMILES | COCCNC(=O)NC(=O)COC(=O)c1cc(S(=O)(=O)N2CCCCC2)ccc1Cl |
| InChI | InChI=1S/C18H24ClN3O7S/c1-28-10-7-20-18(25)21-16(23)12-29-17(24)14-11-13(5-6-15(14)19)30(26,27)22-8-3-2-4-9-22/h5-6,11H,2-4,7-10,12H2,1H3,(H2,20,21,23,25) |
| InChIKey | QWDKFHWBNMGCGO-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.92 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|