C20H26ClN3O7S — CID 16521153
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate (PubChem CID 16521153) has the molecular formula C20H26ClN3O7S and a molecular weight of 487.96 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
|---|---|
| PubChem CID | 16521153 |
| Molecular Formula | C20H26ClN3O7S |
| Molecular Weight | 487.96 g/mol |
| Exact Mass | 487.12 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 2-chloro-5-morpholin-4-ylsulfonylbenzoate |
| SMILES | O=C(COC(=O)c1cc(S(=O)(=O)N2CCOCC2)ccc1Cl)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H26ClN3O7S/c21-17-7-6-15(32(28,29)24-8-10-30-11-9-24)12-16(17)19(26)31-13-18(25)23-20(27)22-14-4-2-1-3-5-14/h6-7,12,14H,1-5,8-11,13H2,(H2,22,23,25,27) |
| InChIKey | NEUCXZJKORSFKB-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.96 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |