C22H31N3O7S — CID 3906998
[2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)propanoate (PubChem CID 3906998) has the molecular formula C22H31N3O7S and a molecular weight of 481.57 g/mol. Its IUPAC name is [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)propanoate.
| Compound Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
|---|---|
| PubChem CID | 3906998 |
| Molecular Formula | C22H31N3O7S |
| Molecular Weight | 481.57 g/mol |
| Exact Mass | 481.19 |
| IUPAC Name | [2-(cyclohexylcarbamoylamino)-2-oxoethyl] 3-(4-morpholin-4-ylsulfonylphenyl)propanoate |
| SMILES | O=C(COC(=O)CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C22H31N3O7S/c26-20(24-22(28)23-18-4-2-1-3-5-18)16-32-21(27)11-8-17-6-9-19(10-7-17)33(29,30)25-12-14-31-15-13-25/h6-7,9-10,18H,1-5,8,11-16H2,(H2,23,24,26,28) |
| InChIKey | XZDIITLKNNBWCI-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.57 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |