C25H37N3O5S — CID 55690967
N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide (PubChem CID 55690967) has the molecular formula C25H37N3O5S and a molecular weight of 491.65 g/mol. Its IUPAC name is N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide.
| Compound Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
|---|---|
| PubChem CID | 55690967 |
| Molecular Formula | C25H37N3O5S |
| Molecular Weight | 491.65 g/mol |
| Exact Mass | 491.25 |
| IUPAC Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(4-morpholin-4-ylsulfonylphenyl)propanamide |
| SMILES | O=C(CCc1ccc(S(=O)(=O)N2CCOCC2)cc1)NC1CCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C25H37N3O5S/c29-24(26-22-12-14-27(15-13-22)25(30)21-4-2-1-3-5-21)11-8-20-6-9-23(10-7-20)34(31,32)28-16-18-33-19-17-28/h6-7,9-10,21-22H,1-5,8,11-19H2,(H,26,29) |
| InChIKey | QUFJJIXHXUOWNP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.65 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |